C21H25N — CID 14941803
N-benzyl-2-[(1S,2R)-2-ethyl-1,2-dihydronaphthalen-1-yl]ethanamine (PubChem CID 14941803) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is N-benzyl-2-[(1S,2R)-2-ethyl-1,2-dihydronaphthalen-1-yl]ethanamine.
| Compound Name | N-benzyl-2-[(1S,2R)-2-ethyl-1,2-dihydronaphthalen-1-yl]ethanamine |
|---|---|
| PubChem CID | 14941803 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-benzyl-2-[(1S,2R)-2-ethyl-1,2-dihydronaphthalen-1-yl]ethanamine |
| SMILES | CC[C@@H]1C=Cc2ccccc2[C@H]1CCNCc1ccccc1 |
| InChI | InChI=1S/C21H25N/c1-2-18-12-13-19-10-6-7-11-20(19)21(18)14-15-22-16-17-8-4-3-5-9-17/h3-13,18,21-22H,2,14-16H2,1H3/t18-,21+/m1/s1 |
| InChIKey | KALAYTDAUFXMQW-NQIIRXRSSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|