C12H15NO2 — CID 141491732
N-benzyl-2-(1,3-dioxol-2-yl)ethanamine (PubChem CID 141491732) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-benzyl-2-(1,3-dioxol-2-yl)ethanamine.
| Compound Name | N-benzyl-2-(1,3-dioxol-2-yl)ethanamine |
|---|---|
| PubChem CID | 141491732 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-benzyl-2-(1,3-dioxol-2-yl)ethanamine |
| SMILES | C1=COC(CCNCc2ccccc2)O1 |
| InChI | InChI=1S/C12H15NO2/c1-2-4-11(5-3-1)10-13-7-6-12-14-8-9-15-12/h1-5,8-9,12-13H,6-7,10H2 |
| InChIKey | PRHKMNQACUYSFI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|