C21H31ClN2O — CID 90707718
2-(chloromethyl)oxirane;N,N'-dibenzylethane-1,2-diamine;ethane (PubChem CID 90707718) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is 2-(chloromethyl)oxirane;N,N'-dibenzylethane-1,2-diamine;ethane.
| Compound Name | 2-(chloromethyl)oxirane;N,N'-dibenzylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 90707718 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(chloromethyl)oxirane;N,N'-dibenzylethane-1,2-diamine;ethane |
| SMILES | CC.ClCC1CO1.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2.C3H5ClO.C2H6/c1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16;4-1-3-2-5-3;1-2/h1-10,17-18H,11-14H2;3H,1-2H2;1-2H3 |
| InChIKey | HJUNTVGCIDROKT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|