C12H12O3 — CID 69276723
1-(1,3-dioxol-2-yl)-3-phenylpropan-2-one (PubChem CID 69276723) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(1,3-dioxol-2-yl)-3-phenylpropan-2-one.
| Compound Name | 1-(1,3-dioxol-2-yl)-3-phenylpropan-2-one |
|---|---|
| PubChem CID | 69276723 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-(1,3-dioxol-2-yl)-3-phenylpropan-2-one |
| SMILES | O=C(Cc1ccccc1)CC1OC=CO1 |
| InChI | InChI=1S/C12H12O3/c13-11(9-12-14-6-7-15-12)8-10-4-2-1-3-5-10/h1-7,12H,8-9H2 |
| InChIKey | GASNOUZUYABLTO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |