C22H28N4O3 — CID 149423008
2-(2-ethoxyethoxy)-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 149423008) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-(2-ethoxyethoxy)-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 149423008 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-(2-ethoxyethoxy)-7-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCOCCOc1ncc2c(n1)N(Cc1ccc(CN3CCCC3)cc1)C(=O)C2 |
| InChI | InChI=1S/C22H28N4O3/c1-2-28-11-12-29-22-23-14-19-13-20(27)26(21(19)24-22)16-18-7-5-17(6-8-18)15-25-9-3-4-10-25/h5-8,14H,2-4,9-13,15-16H2,1H3 |
| InChIKey | YTNWYFQPNXBEHI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|