7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid

C8H8O5 — CID 149431809

IUPAC7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid
SMILESO=C(O)C1=C2CCC(O2)C1C(=O)O
InChIInChI=1S/C8H8O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3,5H,1-2H2,(H,9,10)(H,11,12)
InChIKeyJLTPTNYXQAMQBM-UHFFFAOYSA-N
MW184.15 g/mol
LogP0.22
Rot. Bonds2

About 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid

7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid (PubChem CID 149431809) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid.

Molecular Properties

Compound Name7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid
PubChem CID149431809
Molecular FormulaC8H8O5
Molecular Weight184.15 g/mol
Exact Mass184.04
IUPAC Name7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid
SMILESO=C(O)C1=C2CCC(O2)C1C(=O)O
InChIInChI=1S/C8H8O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3,5H,1-2H2,(H,9,10)(H,11,12)
InChIKeyJLTPTNYXQAMQBM-UHFFFAOYSA-N
XLogP0.22
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 50.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid?
The IUPAC name of 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid (CID 149431809) is 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid.
What is the SMILES notation for 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid?
The canonical SMILES for 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid is O=C(O)C1=C2CCC(O2)C1C(=O)O.
What is the InChIKey of 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid?
The InChIKey is JLTPTNYXQAMQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3,5H,1-2H2,(H,9,10)(H,11,12).
What are the key properties of 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid?
7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid has a molecular weight of 184.15 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[2.2.1]hept-1-ene-2,3-dicarboxylic acid is sourced from PubChem (CID 149431809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).