C14H18F3NO3 — CID 149436683
3-methyl-2-[3-methyl-4-(2,2,2-trifluoroethoxy)anilino]butanoic acid (PubChem CID 149436683) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-methyl-2-[3-methyl-4-(2,2,2-trifluoroethoxy)anilino]butanoic acid.
| Compound Name | 3-methyl-2-[3-methyl-4-(2,2,2-trifluoroethoxy)anilino]butanoic acid |
|---|---|
| PubChem CID | 149436683 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-methyl-2-[3-methyl-4-(2,2,2-trifluoroethoxy)anilino]butanoic acid |
| SMILES | Cc1cc(NC(C(=O)O)C(C)C)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C14H18F3NO3/c1-8(2)12(13(19)20)18-10-4-5-11(9(3)6-10)21-7-14(15,16)17/h4-6,8,12,18H,7H2,1-3H3,(H,19,20) |
| InChIKey | LJYIUSFMTNCSEP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|