C17H27F3N2O — CID 97309851
(5S)-1-N,1-N-dimethyl-5-N-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]hexane-1,5-diamine (PubChem CID 97309851) has the molecular formula C17H27F3N2O and a molecular weight of 332.41 g/mol. Its IUPAC name is (5S)-1-N,1-N-dimethyl-5-N-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]hexane-1,5-diamine.
| Compound Name | (5S)-1-N,1-N-dimethyl-5-N-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]hexane-1,5-diamine |
|---|---|
| PubChem CID | 97309851 |
| Molecular Formula | C17H27F3N2O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (5S)-1-N,1-N-dimethyl-5-N-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]hexane-1,5-diamine |
| SMILES | Cc1cc(N[C@@H](C)CCCCN(C)C)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H27F3N2O/c1-13-11-15(8-9-16(13)23-12-17(18,19)20)21-14(2)7-5-6-10-22(3)4/h8-9,11,14,21H,5-7,10,12H2,1-4H3/t14-/m0/s1 |
| InChIKey | OIXJJQWLENGPLZ-AWEZNQCLSA-N |
| XLogP | 4.47 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|