C15H22F3NO — CID 43689164
N-(5-methylhexan-2-yl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 43689164) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-(5-methylhexan-2-yl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 43689164 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(5-methylhexan-2-yl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CC(C)CCC(C)Nc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H22F3NO/c1-11(2)8-9-12(3)19-13-6-4-5-7-14(13)20-10-15(16,17)18/h4-7,11-12,19H,8-10H2,1-3H3 |
| InChIKey | KLLTYCIMZSXOTB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |