C15H22F3NO2 — CID 81400610
2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)anilino]methyl]butan-1-ol (PubChem CID 81400610) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)anilino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)anilino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 81400610 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)anilino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H22F3NO2/c1-3-14(4-2,10-20)9-19-12-7-5-6-8-13(12)21-11-15(16,17)18/h5-8,19-20H,3-4,9-11H2,1-2H3 |
| InChIKey | VFHFDYPWVJYJAC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |