C12H14N2 — CID 149442885
2-[(2S)-2-[(2Z)-penta-2,4-dien-2-yl]-2,3-dihydropyridin-6-yl]acetonitrile (PubChem CID 149442885) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-[(2S)-2-[(2Z)-penta-2,4-dien-2-yl]-2,3-dihydropyridin-6-yl]acetonitrile.
| Compound Name | 2-[(2S)-2-[(2Z)-penta-2,4-dien-2-yl]-2,3-dihydropyridin-6-yl]acetonitrile |
|---|---|
| PubChem CID | 149442885 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-[(2S)-2-[(2Z)-penta-2,4-dien-2-yl]-2,3-dihydropyridin-6-yl]acetonitrile |
| SMILES | C=C/C=C(/C)[C@@H]1CC=CC(CC#N)=N1 |
| InChI | InChI=1S/C12H14N2/c1-3-5-10(2)12-7-4-6-11(14-12)8-9-13/h3-6,12H,1,7-8H2,2H3/b10-5-/t12-/m0/s1 |
| InChIKey | YWCIBPCDTNJSQR-JSJZCHLLSA-N |
| XLogP | 2.80 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|