C10H11N3 — CID 130243377
6-[(2E)-penta-2,4-dien-2-yl]-4,5-dihydropyrimidine-4-carbonitrile (PubChem CID 130243377) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 6-[(2E)-penta-2,4-dien-2-yl]-4,5-dihydropyrimidine-4-carbonitrile.
| Compound Name | 6-[(2E)-penta-2,4-dien-2-yl]-4,5-dihydropyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 130243377 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 6-[(2E)-penta-2,4-dien-2-yl]-4,5-dihydropyrimidine-4-carbonitrile |
| SMILES | C=C/C=C(\C)C1=NC=NC(C#N)C1 |
| InChI | InChI=1S/C10H11N3/c1-3-4-8(2)10-5-9(6-11)12-7-13-10/h3-4,7,9H,1,5H2,2H3/b8-4+ |
| InChIKey | NZQQYNWMSOHGOF-XBXARRHUSA-N |
| XLogP | 1.88 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|