C16H11NO3 — CID 149450046
3-methyl-3,3a-dihydronaphtho[2,3-g][2,1]benzoxazole-6,11-dione (PubChem CID 149450046) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-methyl-3,3a-dihydronaphtho[2,3-g][2,1]benzoxazole-6,11-dione.
| Compound Name | 3-methyl-3,3a-dihydronaphtho[2,3-g][2,1]benzoxazole-6,11-dione |
|---|---|
| PubChem CID | 149450046 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-methyl-3,3a-dihydronaphtho[2,3-g][2,1]benzoxazole-6,11-dione |
| SMILES | CC1ON=C2C3=C(C=CC21)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C16H11NO3/c1-8-9-6-7-12-13(14(9)17-20-8)16(19)11-5-3-2-4-10(11)15(12)18/h2-9H,1H3 |
| InChIKey | YXLIHKCGFBCUNS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|