C20H25N7O — CID 149457534
1-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]but-3-en-2-one (PubChem CID 149457534) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]but-3-en-2-one.
| Compound Name | 1-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 149457534 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]but-3-en-2-one |
| SMILES | C=CC(=O)CC1CCC(Nc2nc(Nc3cnn(C)c3)nc3cc[nH]c23)CC1 |
| InChI | InChI=1S/C20H25N7O/c1-3-16(28)10-13-4-6-14(7-5-13)23-19-18-17(8-9-21-18)25-20(26-19)24-15-11-22-27(2)12-15/h3,8-9,11-14,21H,1,4-7,10H2,2H3,(H2,23,24,25,26) |
| InChIKey | YYWCSUKIDDJJPH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|