C19H17F3N2O2 — CID 149457957
2-(2-cyclopropyl-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyridine-4-carboxamide (PubChem CID 149457957) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-(2-cyclopropyl-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-cyclopropyl-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 149457957 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-(2-cyclopropyl-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1ccnc(CC(=O)C2CC2)c1 |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)15-3-1-2-12(8-15)11-24-18(26)14-6-7-23-16(9-14)10-17(25)13-4-5-13/h1-3,6-9,13H,4-5,10-11H2,(H,24,26) |
| InChIKey | YYYHBEPLOQGSRD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |