About 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one
3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one (PubChem CID 149468239) has the molecular formula C23H24ClF2NO2
and a molecular weight of 419.90 g/mol. Its IUPAC name is 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one.
Molecular Properties
| Compound Name | 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one |
| PubChem CID | 149468239 |
| Molecular Formula | C23H24ClF2NO2 |
| Molecular Weight | 419.90 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one |
| SMILES | O=C1CCC(c2ccc3c(C(=O)CCC4CCC(F)(F)CC4)c(Cl)ccc3n2)C1 |
| InChI | InChI=1S/C23H24ClF2NO2/c24-18-5-7-20-17(4-6-19(27-20)15-2-3-16(28)13-15)22(18)21(29)8-1-14-9-11-23(25,26)12-10-14/h4-7,14-15H,1-3,8-13H2 |
| InChIKey | ZAVUEAWPVYPCQJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.90 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one?
The IUPAC name of 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one (CID 149468239) is 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one.
What is the SMILES notation for 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one?
The canonical SMILES for 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one is O=C1CCC(c2ccc3c(C(=O)CCC4CCC(F)(F)CC4)c(Cl)ccc3n2)C1.
What is the InChIKey of 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one?
The InChIKey is ZAVUEAWPVYPCQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClF2NO2/c24-18-5-7-20-17(4-6-19(27-20)15-2-3-16(28)13-15)22(18)21(29)8-1-14-9-11-23(25,26)12-10-14/h4-7,14-15H,1-3,8-13H2.
What are the key properties of 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one?
3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one has a molecular weight of 419.90 g/mol, XLogP of 6.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-chloro-5-[3-(4,4-difluorocyclohexyl)propanoyl]quinolin-2-yl]cyclopentan-1-one is sourced from PubChem (CID 149468239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).