C10H9I2N3 — CID 14947216
4,5-bis(iodomethyl)-2-phenyltriazole (PubChem CID 14947216) has the molecular formula C10H9I2N3 and a molecular weight of 425.01 g/mol. Its IUPAC name is 4,5-bis(iodomethyl)-2-phenyltriazole.
| Compound Name | 4,5-bis(iodomethyl)-2-phenyltriazole |
|---|---|
| PubChem CID | 14947216 |
| Molecular Formula | C10H9I2N3 |
| Molecular Weight | 425.01 g/mol |
| Exact Mass | 424.89 |
| IUPAC Name | 4,5-bis(iodomethyl)-2-phenyltriazole |
| SMILES | ICc1nn(-c2ccccc2)nc1CI |
| InChI | InChI=1S/C10H9I2N3/c11-6-9-10(7-12)14-15(13-9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ONGQRSWHDDLMBY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|