C16H20N2O4S2 — CID 14948232
2,4,6-trimethyl-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide (PubChem CID 14948232) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2,4,6-trimethyl-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide.
| Compound Name | 2,4,6-trimethyl-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 14948232 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2,4,6-trimethyl-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNS(=O)(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-11-5-7-15(8-6-11)23(19,20)17-18-24(21,22)16-13(3)9-12(2)10-14(16)4/h5-10,17-18H,1-4H3 |
| InChIKey | PFQFNKOXTIAPBU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|