C21H11N3O2S — CID 149489817
2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-6-yl]-1,3-benzoxazole (PubChem CID 149489817) has the molecular formula C21H11N3O2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-6-yl]-1,3-benzoxazole.
| Compound Name | 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-6-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 149489817 |
| Molecular Formula | C21H11N3O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-6-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc4nc(-c5ccc6cnoc6c5)sc4c3)nc2c1 |
| InChI | InChI=1S/C21H11N3O2S/c1-2-4-17-15(3-1)23-20(25-17)12-7-8-16-19(10-12)27-21(24-16)13-5-6-14-11-22-26-18(14)9-13/h1-11H |
| InChIKey | ZEWFRBOGSLGNIR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |