C18H21NO3 — CID 14952672
(3S,4S)-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine (PubChem CID 14952672) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3S,4S)-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine.
| Compound Name | (3S,4S)-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine |
|---|---|
| PubChem CID | 14952672 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3S,4S)-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine |
| SMILES | ON1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C18H21NO3/c20-19-11-17(21-13-15-7-3-1-4-8-15)18(12-19)22-14-16-9-5-2-6-10-16/h1-10,17-18,20H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | FYYBAYDUURHSNN-ROUUACIJSA-N |
| XLogP | 2.86 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |