C19H17NO2 — CID 14957733
1-(7-ethenyl-3,3-dimethyl-4-oxonaphthalen-1-yl)pyridin-2-one (PubChem CID 14957733) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(7-ethenyl-3,3-dimethyl-4-oxonaphthalen-1-yl)pyridin-2-one.
| Compound Name | 1-(7-ethenyl-3,3-dimethyl-4-oxonaphthalen-1-yl)pyridin-2-one |
|---|---|
| PubChem CID | 14957733 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-(7-ethenyl-3,3-dimethyl-4-oxonaphthalen-1-yl)pyridin-2-one |
| SMILES | C=Cc1ccc2c(c1)C(n1ccccc1=O)=CC(C)(C)C2=O |
| InChI | InChI=1S/C19H17NO2/c1-4-13-8-9-14-15(11-13)16(12-19(2,3)18(14)22)20-10-6-5-7-17(20)21/h4-12H,1H2,2-3H3 |
| InChIKey | HQUJXYNVUBPBTM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |