C29H28N2O5S — CID 1495841
4-[(6R,9S)-9-(4-methoxyphenyl)-3-methyl-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid (PubChem CID 1495841) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is 4-[(6R,9S)-9-(4-methoxyphenyl)-3-methyl-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(6R,9S)-9-(4-methoxyphenyl)-3-methyl-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 1495841 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 4-[(6R,9S)-9-(4-methoxyphenyl)-3-methyl-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanoic acid |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)Nc2ccc(C)cc2N(C(=O)CCC(=O)O)[C@H]3c2cccs2)cc1 |
| InChI | InChI=1S/C29H28N2O5S/c1-17-5-10-21-23(14-17)31(26(33)11-12-27(34)35)29(25-4-3-13-37-25)28-22(30-21)15-19(16-24(28)32)18-6-8-20(36-2)9-7-18/h3-10,13-14,19,29-30H,11-12,15-16H2,1-2H3,(H,34,35)/t19-,29-/m0/s1 |
| InChIKey | MLQHAYFWNWAGKS-SLQAJWMNSA-N |
| XLogP | 5.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |