C29H29FN2O2S — CID 40920022
(6R,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 40920022) has the molecular formula C29H29FN2O2S and a molecular weight of 488.63 g/mol. Its IUPAC name is (6R,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 40920022 |
| Molecular Formula | C29H29FN2O2S |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (6R,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C(C(=O)C[C@H](c3ccc(F)cc3)C2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C29H29FN2O2S/c1-2-3-4-11-27(34)32-24-9-6-5-8-22(24)31-23-17-20(19-12-14-21(30)15-13-19)18-25(33)28(23)29(32)26-10-7-16-35-26/h5-10,12-16,20,29,31H,2-4,11,17-18H2,1H3/t20-,29+/m1/s1 |
| InChIKey | IXPOBCVUTCJUTR-OLILMLBXSA-N |
| XLogP | 7.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|