C31H30FN3O4 — CID 27905963
(6S,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 27905963) has the molecular formula C31H30FN3O4 and a molecular weight of 527.60 g/mol. Its IUPAC name is (6S,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 27905963 |
| Molecular Formula | C31H30FN3O4 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (6S,9R)-9-(4-fluorophenyl)-5-hexanoyl-6-(3-nitrophenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C(C(=O)C[C@H](c3ccc(F)cc3)C2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H30FN3O4/c1-2-3-4-12-29(37)34-27-11-6-5-10-25(27)33-26-18-22(20-13-15-23(32)16-14-20)19-28(36)30(26)31(34)21-8-7-9-24(17-21)35(38)39/h5-11,13-17,22,31,33H,2-4,12,18-19H2,1H3/t22-,31+/m1/s1 |
| InChIKey | QPJFBALCNWJORW-UVDDSOTQSA-N |
| XLogP | 7.21 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|