C15H22O5 — CID 14965795
methyl (5Z,7E,9E)-11-(2-methoxyacetyl)oxyundeca-5,7,9-trienoate (PubChem CID 14965795) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (5Z,7E,9E)-11-(2-methoxyacetyl)oxyundeca-5,7,9-trienoate.
| Compound Name | methyl (5Z,7E,9E)-11-(2-methoxyacetyl)oxyundeca-5,7,9-trienoate |
|---|---|
| PubChem CID | 14965795 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | methyl (5Z,7E,9E)-11-(2-methoxyacetyl)oxyundeca-5,7,9-trienoate |
| SMILES | COCC(=O)OC/C=C/C=C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C15H22O5/c1-18-13-15(17)20-12-10-8-6-4-3-5-7-9-11-14(16)19-2/h3-6,8,10H,7,9,11-13H2,1-2H3/b5-3-,6-4+,10-8+ |
| InChIKey | BTFWWPFMRSHJJL-JBJAKCJUSA-N |
| XLogP | 2.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|