C13H21NO6P2 — CID 14966653
[(4-benzylpiperidin-1-yl)-phosphonomethyl]phosphonic acid (PubChem CID 14966653) has the molecular formula C13H21NO6P2 and a molecular weight of 349.26 g/mol. Its IUPAC name is [(4-benzylpiperidin-1-yl)-phosphonomethyl]phosphonic acid.
| Compound Name | [(4-benzylpiperidin-1-yl)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 14966653 |
| Molecular Formula | C13H21NO6P2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(4-benzylpiperidin-1-yl)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(N1CCC(Cc2ccccc2)CC1)P(=O)(O)O |
| InChI | InChI=1S/C13H21NO6P2/c15-21(16,17)13(22(18,19)20)14-8-6-12(7-9-14)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | XLSYISJLJBINOA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|