About (4-benzylpiperidin-1-yl) hydrogen carbonate
(4-benzylpiperidin-1-yl) hydrogen carbonate (PubChem CID 90757299) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-benzylpiperidin-1-yl) hydrogen carbonate |
| PubChem CID | 90757299 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (4-benzylpiperidin-1-yl) hydrogen carbonate |
| SMILES | O=C(O)ON1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H17NO3/c15-13(16)17-14-8-6-12(7-9-14)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,15,16) |
| InChIKey | PKZUDSXRDCSGCL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-benzylpiperidin-1-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylpiperidin-1-yl) hydrogen carbonate?
The IUPAC name of (4-benzylpiperidin-1-yl) hydrogen carbonate (CID 90757299) is (4-benzylpiperidin-1-yl) hydrogen carbonate.
What is the SMILES notation for (4-benzylpiperidin-1-yl) hydrogen carbonate?
The canonical SMILES for (4-benzylpiperidin-1-yl) hydrogen carbonate is O=C(O)ON1CCC(Cc2ccccc2)CC1.
What is the InChIKey of (4-benzylpiperidin-1-yl) hydrogen carbonate?
The InChIKey is PKZUDSXRDCSGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c15-13(16)17-14-8-6-12(7-9-14)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,15,16).
What are the key properties of (4-benzylpiperidin-1-yl) hydrogen carbonate?
(4-benzylpiperidin-1-yl) hydrogen carbonate has a molecular weight of 235.28 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylpiperidin-1-yl) hydrogen carbonate is sourced from PubChem (CID 90757299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).