C17H19NO2 — CID 14973106
2-(3-benzyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 14973106) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(3-benzyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(3-benzyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 14973106 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(3-benzyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | Cc1cc(Cc2ccccc2)c(C2=NC(C)(C)CO2)o1 |
| InChI | InChI=1S/C17H19NO2/c1-12-9-14(10-13-7-5-4-6-8-13)15(20-12)16-18-17(2,3)11-19-16/h4-9H,10-11H2,1-3H3 |
| InChIKey | AOGRKJUJIDJUOH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |