C21H27NO3 — CID 3007727
2-[4-[7-(4-methylfuran-2-yl)heptoxy]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 3007727) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[4-[7-(4-methylfuran-2-yl)heptoxy]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[4-[7-(4-methylfuran-2-yl)heptoxy]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 3007727 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[4-[7-(4-methylfuran-2-yl)heptoxy]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1coc(CCCCCCCOc2ccc(C3=NCCO3)cc2)c1 |
| InChI | InChI=1S/C21H27NO3/c1-17-15-20(25-16-17)7-5-3-2-4-6-13-23-19-10-8-18(9-11-19)21-22-12-14-24-21/h8-11,15-16H,2-7,12-14H2,1H3 |
| InChIKey | HTSNUFNQEZOTNU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|