C20H17NO4Se — CID 14976421
diethyl 10H-[1]benzoselenolo[3,2-b]indole-2,7-dicarboxylate (PubChem CID 14976421) has the molecular formula C20H17NO4Se and a molecular weight of 414.32 g/mol. Its IUPAC name is diethyl 10H-[1]benzoselenolo[3,2-b]indole-2,7-dicarboxylate.
| Compound Name | diethyl 10H-[1]benzoselenolo[3,2-b]indole-2,7-dicarboxylate |
|---|---|
| PubChem CID | 14976421 |
| Molecular Formula | C20H17NO4Se |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | diethyl 10H-[1]benzoselenolo[3,2-b]indole-2,7-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[nH]c1c3ccc(C(=O)OCC)cc3[se]c21 |
| InChI | InChI=1S/C20H17NO4Se/c1-3-24-19(22)11-5-7-13-15(9-11)21-17-14-8-6-12(20(23)25-4-2)10-16(14)26-18(13)17/h5-10,21H,3-4H2,1-2H3 |
| InChIKey | RAOGILXYGVZYKT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|