C13H10FN3O3 — CID 142467597
ethyl 4-fluorooxy-5H-pyrimido[5,4-b]indole-8-carboxylate (PubChem CID 142467597) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is ethyl 4-fluorooxy-5H-pyrimido[5,4-b]indole-8-carboxylate.
| Compound Name | ethyl 4-fluorooxy-5H-pyrimido[5,4-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 142467597 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | ethyl 4-fluorooxy-5H-pyrimido[5,4-b]indole-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c3c(OF)ncnc3c2c1 |
| InChI | InChI=1S/C13H10FN3O3/c1-2-19-13(18)7-3-4-9-8(5-7)10-11(17-9)12(20-14)16-6-15-10/h3-6,17H,2H2,1H3 |
| InChIKey | BUMXAMBKZXGENK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |