C16H15N3O4 — CID 54006151
diethyl 5H-pyrimido[5,4-b]indole-2,8-dicarboxylate (PubChem CID 54006151) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is diethyl 5H-pyrimido[5,4-b]indole-2,8-dicarboxylate.
| Compound Name | diethyl 5H-pyrimido[5,4-b]indole-2,8-dicarboxylate |
|---|---|
| PubChem CID | 54006151 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | diethyl 5H-pyrimido[5,4-b]indole-2,8-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c3cnc(C(=O)OCC)nc3c2c1 |
| InChI | InChI=1S/C16H15N3O4/c1-3-22-15(20)9-5-6-11-10(7-9)13-12(18-11)8-17-14(19-13)16(21)23-4-2/h5-8,18H,3-4H2,1-2H3 |
| InChIKey | QRYCRJUOMBLUHT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |