C13H22OSi2 — CID 14976474
1,7-bis(trimethylsilyl)hepta-1,6-diyn-3-one (PubChem CID 14976474) has the molecular formula C13H22OSi2 and a molecular weight of 250.49 g/mol. Its IUPAC name is 1,7-bis(trimethylsilyl)hepta-1,6-diyn-3-one.
| Compound Name | 1,7-bis(trimethylsilyl)hepta-1,6-diyn-3-one |
|---|---|
| PubChem CID | 14976474 |
| Molecular Formula | C13H22OSi2 |
| Molecular Weight | 250.49 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1,7-bis(trimethylsilyl)hepta-1,6-diyn-3-one |
| SMILES | C[Si](C)(C)C#CCCC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi2/c1-15(2,3)11-8-7-9-13(14)10-12-16(4,5)6/h7,9H2,1-6H3 |
| InChIKey | SBUUEVTZTSTRAW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|