C18H16FN3O5S2 — CID 1497734
1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-fluorophenyl)sulfonylurea (PubChem CID 1497734) has the molecular formula C18H16FN3O5S2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-fluorophenyl)sulfonylurea.
| Compound Name | 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-fluorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 1497734 |
| Molecular Formula | C18H16FN3O5S2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-fluorophenyl)sulfonylurea |
| SMILES | COc1ccc(-c2csc(NC(=O)NS(=O)(=O)c3ccccc3F)n2)cc1OC |
| InChI | InChI=1S/C18H16FN3O5S2/c1-26-14-8-7-11(9-15(14)27-2)13-10-28-18(20-13)21-17(23)22-29(24,25)16-6-4-3-5-12(16)19/h3-10H,1-2H3,(H2,20,21,22,23) |
| InChIKey | FDJPRDVBUKHBLM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |