C31H35NO8 — CID 14977913
3-[[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-1-oxidopyridin-1-ium-2-yl]methoxy]benzoic acid (PubChem CID 14977913) has the molecular formula C31H35NO8 and a molecular weight of 549.62 g/mol. Its IUPAC name is 3-[[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-1-oxidopyridin-1-ium-2-yl]methoxy]benzoic acid.
| Compound Name | 3-[[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-1-oxidopyridin-1-ium-2-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 14977913 |
| Molecular Formula | C31H35NO8 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 3-[[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-1-oxidopyridin-1-ium-2-yl]methoxy]benzoic acid |
| SMILES | COc1ccc(CCCCCCCCOc2ccc(COc3cccc(C(=O)O)c3)[n+]([O-])c2/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C31H35NO8/c1-38-26-15-12-23(13-16-26)9-6-4-2-3-5-7-20-39-29-18-14-25(32(37)28(29)17-19-30(33)34)22-40-27-11-8-10-24(21-27)31(35)36/h8,10-19,21H,2-7,9,20,22H2,1H3,(H,33,34)(H,35,36)/b19-17+ |
| InChIKey | NJRBDYQJYBZHEH-HTXNQAPBSA-N |
| XLogP | 5.67 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|