C9H9NO2 — CID 14978493
1,6,7,8-tetrahydroquinoline-4,5-dione (PubChem CID 14978493) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1,6,7,8-tetrahydroquinoline-4,5-dione.
| Compound Name | 1,6,7,8-tetrahydroquinoline-4,5-dione |
|---|---|
| PubChem CID | 14978493 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1,6,7,8-tetrahydroquinoline-4,5-dione |
| SMILES | O=C1CCCc2[nH]ccc(=O)c21 |
| InChI | InChI=1S/C9H9NO2/c11-7-3-1-2-6-9(7)8(12)4-5-10-6/h4-5H,1-3H2,(H,10,12) |
| InChIKey | RCYRGXOFTDOXQZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |