C19H21NO2 — CID 14979673
(3aS,5S,7aS)-1-benzyl-5-phenyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole (PubChem CID 14979673) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (3aS,5S,7aS)-1-benzyl-5-phenyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole.
| Compound Name | (3aS,5S,7aS)-1-benzyl-5-phenyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 14979673 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3aS,5S,7aS)-1-benzyl-5-phenyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
| SMILES | c1ccc(CN2OC[C@H]3C[C@@H](c4ccccc4)OC[C@H]32)cc1 |
| InChI | InChI=1S/C19H21NO2/c1-3-7-15(8-4-1)12-20-18-14-21-19(11-17(18)13-22-20)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18-,19+/m1/s1 |
| InChIKey | AWBJXKWFJAZODW-QRVBRYPASA-N |
| XLogP | 3.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |