C14H27NO4 — CID 14979883
ethyl N-[(Z)-2-hydroxy-8-methoxy-2,6-dimethyloct-6-en-3-yl]carbamate (PubChem CID 14979883) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is ethyl N-[(Z)-2-hydroxy-8-methoxy-2,6-dimethyloct-6-en-3-yl]carbamate.
| Compound Name | ethyl N-[(Z)-2-hydroxy-8-methoxy-2,6-dimethyloct-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 14979883 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethyl N-[(Z)-2-hydroxy-8-methoxy-2,6-dimethyloct-6-en-3-yl]carbamate |
| SMILES | CCOC(=O)NC(CC/C(C)=C\COC)C(C)(C)O |
| InChI | InChI=1S/C14H27NO4/c1-6-19-13(16)15-12(14(3,4)17)8-7-11(2)9-10-18-5/h9,12,17H,6-8,10H2,1-5H3,(H,15,16)/b11-9- |
| InChIKey | GJSXVMIJKBRWCA-LUAWRHEFSA-N |
| XLogP | 2.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|