C33H35N3O4 — CID 14982983
3-[1-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 14982983) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-[1-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 14982983 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 3-[1-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1cc(-c2ccccc2)oc2ccc(OCCCCCCN3CCC(n4c(=O)[nH]c5ccccc54)CC3)cc12 |
| InChI | InChI=1S/C33H35N3O4/c37-30-23-32(24-10-4-3-5-11-24)40-31-15-14-26(22-27(30)31)39-21-9-2-1-8-18-35-19-16-25(17-20-35)36-29-13-7-6-12-28(29)34-33(36)38/h3-7,10-15,22-23,25H,1-2,8-9,16-21H2,(H,34,38) |
| InChIKey | VQTYANOITYVNNB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|