C13H13F4N3O2S — CID 1498304
2-[3-tert-butyl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 1498304) has the molecular formula C13H13F4N3O2S and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-tert-butyl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 1498304 |
| Molecular Formula | C13H13F4N3O2S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[3-tert-butyl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C(F)(F)C(F)F)n(-c2nc(C(=O)O)cs2)n1 |
| InChI | InChI=1S/C13H13F4N3O2S/c1-12(2,3)7-4-8(13(16,17)10(14)15)20(19-7)11-18-6(5-23-11)9(21)22/h4-5,10H,1-3H3,(H,21,22) |
| InChIKey | QQHPWFPJPQIACV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|