C12H10ClF3O2S — CID 14984519
methyl 2-chloro-2,3,3-trifluoro-1-phenylsulfanylcyclobutane-1-carboxylate (PubChem CID 14984519) has the molecular formula C12H10ClF3O2S and a molecular weight of 310.72 g/mol. Its IUPAC name is methyl 2-chloro-2,3,3-trifluoro-1-phenylsulfanylcyclobutane-1-carboxylate.
| Compound Name | methyl 2-chloro-2,3,3-trifluoro-1-phenylsulfanylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 14984519 |
| Molecular Formula | C12H10ClF3O2S |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | methyl 2-chloro-2,3,3-trifluoro-1-phenylsulfanylcyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(Sc2ccccc2)CC(F)(F)C1(F)Cl |
| InChI | InChI=1S/C12H10ClF3O2S/c1-18-9(17)10(7-11(14,15)12(10,13)16)19-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | VXALPRLGZBDJAI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|