About 1-tert-butylimidazo[4,5-c]quinoline
1-tert-butylimidazo[4,5-c]quinoline (PubChem CID 14986962) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is 1-tert-butylimidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 1-tert-butylimidazo[4,5-c]quinoline |
| PubChem CID | 14986962 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-tert-butylimidazo[4,5-c]quinoline |
| SMILES | CC(C)(C)n1cnc2cnc3ccccc3c21 |
| InChI | InChI=1S/C14H15N3/c1-14(2,3)17-9-16-12-8-15-11-7-5-4-6-10(11)13(12)17/h4-9H,1-3H3 |
| InChIKey | BUWRIWGTYOWSQH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butylimidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylimidazo[4,5-c]quinoline?
The IUPAC name of 1-tert-butylimidazo[4,5-c]quinoline (CID 14986962) is 1-tert-butylimidazo[4,5-c]quinoline.
What is the SMILES notation for 1-tert-butylimidazo[4,5-c]quinoline?
The canonical SMILES for 1-tert-butylimidazo[4,5-c]quinoline is CC(C)(C)n1cnc2cnc3ccccc3c21.
What is the InChIKey of 1-tert-butylimidazo[4,5-c]quinoline?
The InChIKey is BUWRIWGTYOWSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3/c1-14(2,3)17-9-16-12-8-15-11-7-5-4-6-10(11)13(12)17/h4-9H,1-3H3.
What are the key properties of 1-tert-butylimidazo[4,5-c]quinoline?
1-tert-butylimidazo[4,5-c]quinoline has a molecular weight of 225.30 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylimidazo[4,5-c]quinoline is sourced from PubChem (CID 14986962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).