C20H16N4 — CID 150053461
2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)-2-methylpropanenitrile (PubChem CID 150053461) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)-2-methylpropanenitrile.
| Compound Name | 2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 150053461 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc(-n2cnc3cnc4ccccc4c32)cc1 |
| InChI | InChI=1S/C20H16N4/c1-20(2,12-21)14-7-9-15(10-8-14)24-13-23-18-11-22-17-6-4-3-5-16(17)19(18)24/h3-11,13H,1-2H3 |
| InChIKey | DLUCZROSYJEAQY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |