C27H23N5 — CID 175554808
2-[4-[8-(4-aminophenyl)-2-methylimidazo[4,5-c]quinolin-1-yl]phenyl]-2-methylpropanenitrile (PubChem CID 175554808) has the molecular formula C27H23N5 and a molecular weight of 417.52 g/mol. Its IUPAC name is 2-[4-[8-(4-aminophenyl)-2-methylimidazo[4,5-c]quinolin-1-yl]phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[8-(4-aminophenyl)-2-methylimidazo[4,5-c]quinolin-1-yl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 175554808 |
| Molecular Formula | C27H23N5 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[4-[8-(4-aminophenyl)-2-methylimidazo[4,5-c]quinolin-1-yl]phenyl]-2-methylpropanenitrile |
| SMILES | Cc1nc2cnc3ccc(-c4ccc(N)cc4)cc3c2n1-c1ccc(C(C)(C)C#N)cc1 |
| InChI | InChI=1S/C27H23N5/c1-17-31-25-15-30-24-13-6-19(18-4-9-21(29)10-5-18)14-23(24)26(25)32(17)22-11-7-20(8-12-22)27(2,3)16-28/h4-15H,29H2,1-3H3 |
| InChIKey | JIHKNYZELVNQRY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|