C24H16F3N3O — CID 175554766
1-(4-methoxyphenyl)-2-methyl-8-(3,4,5-trifluorophenyl)imidazo[4,5-c]quinoline (PubChem CID 175554766) has the molecular formula C24H16F3N3O and a molecular weight of 419.41 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-methyl-8-(3,4,5-trifluorophenyl)imidazo[4,5-c]quinoline.
| Compound Name | 1-(4-methoxyphenyl)-2-methyl-8-(3,4,5-trifluorophenyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 175554766 |
| Molecular Formula | C24H16F3N3O |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-methyl-8-(3,4,5-trifluorophenyl)imidazo[4,5-c]quinoline |
| SMILES | COc1ccc(-n2c(C)nc3cnc4ccc(-c5cc(F)c(F)c(F)c5)cc4c32)cc1 |
| InChI | InChI=1S/C24H16F3N3O/c1-13-29-22-12-28-21-8-3-14(15-10-19(25)23(27)20(26)11-15)9-18(21)24(22)30(13)16-4-6-17(31-2)7-5-16/h3-12H,1-2H3 |
| InChIKey | JPCZIEYOXLCUPM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|