About dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate
dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 14992898) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate.
Analyze dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
The IUPAC name of dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate (CID 14992898) is dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate.
What is the SMILES notation for dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
The canonical SMILES for dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate is COC(=O)[C@@H]1OC(C(C)C)O[C@H]1C(=O)OC.
What is the InChIKey of dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
The InChIKey is IGCXGHHXIQSSBV-RNFRBKRXSA-N. The full InChI is InChI=1S/C10H16O6/c1-5(2)10-15-6(8(11)13-3)7(16-10)9(12)14-4/h5-7,10H,1-4H3/t6-,7-/m1/s1.
What are the key properties of dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate has a molecular weight of 232.23 g/mol, XLogP of 0.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (4R,5R)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate is sourced from PubChem (CID 14992898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).