About 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate
2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate (PubChem CID 150004969) has the molecular formula C9H16N2O4
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate.
Molecular Properties
| Compound Name | 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate |
| PubChem CID | 150004969 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate |
| SMILES | COCOCCOC(=O)CCNCC#N |
| InChI | InChI=1S/C9H16N2O4/c1-13-8-14-6-7-15-9(12)2-4-11-5-3-10/h11H,2,4-8H2,1H3 |
| InChIKey | DCBWCGHJMYXDFJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate?
The IUPAC name of 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate (CID 150004969) is 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate.
What is the SMILES notation for 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate?
The canonical SMILES for 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate is COCOCCOC(=O)CCNCC#N.
What is the InChIKey of 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate?
The InChIKey is DCBWCGHJMYXDFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O4/c1-13-8-14-6-7-15-9(12)2-4-11-5-3-10/h11H,2,4-8H2,1H3.
What are the key properties of 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate?
2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate has a molecular weight of 216.24 g/mol, XLogP of -0.35, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethoxy)ethyl 3-(cyanomethylamino)propanoate is sourced from PubChem (CID 150004969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).