About 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate
2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate (PubChem CID 54030765) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate |
| PubChem CID | 54030765 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate |
| SMILES | C/C=C/COCCOC(=O)CCNCCCC |
| InChI | InChI=1S/C13H25NO3/c1-3-5-8-14-9-7-13(15)17-12-11-16-10-6-4-2/h4,6,14H,3,5,7-12H2,1-2H3/b6-4+ |
| InChIKey | YNYKAUJJKPKIAR-GQCTYLIASA-N |
| XLogP | 1.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate?
The IUPAC name of 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate (CID 54030765) is 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate.
What is the SMILES notation for 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate?
The canonical SMILES for 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate is C/C=C/COCCOC(=O)CCNCCCC.
What is the InChIKey of 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate?
The InChIKey is YNYKAUJJKPKIAR-GQCTYLIASA-N. The full InChI is InChI=1S/C13H25NO3/c1-3-5-8-14-9-7-13(15)17-12-11-16-10-6-4-2/h4,6,14H,3,5,7-12H2,1-2H3/b6-4+.
What are the key properties of 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate?
2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate has a molecular weight of 243.35 g/mol, XLogP of 1.90, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enoxy]ethyl 3-(butylamino)propanoate is sourced from PubChem (CID 54030765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).