About 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine
1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine (PubChem CID 150014617) has the molecular formula C23H31BrN2O
and a molecular weight of 431.42 g/mol. Its IUPAC name is 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine |
| PubChem CID | 150014617 |
| Molecular Formula | C23H31BrN2O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine |
| SMILES | CN(C)C(CCBr)Cc1ccc(N2CCOCC2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C23H31BrN2O/c1-25(2)22(10-11-24)17-20-8-9-23(26-12-14-27-15-13-26)18-21(20)16-19-6-4-3-5-7-19/h3-9,18,22H,10-17H2,1-2H3 |
| InChIKey | DDZNYPFIMHYOJN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine?
The IUPAC name of 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine (CID 150014617) is 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine.
What is the SMILES notation for 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine?
The canonical SMILES for 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine is CN(C)C(CCBr)Cc1ccc(N2CCOCC2)cc1Cc1ccccc1.
What is the InChIKey of 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine?
The InChIKey is DDZNYPFIMHYOJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31BrN2O/c1-25(2)22(10-11-24)17-20-8-9-23(26-12-14-27-15-13-26)18-21(20)16-19-6-4-3-5-7-19/h3-9,18,22H,10-17H2,1-2H3.
What are the key properties of 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine?
1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine has a molecular weight of 431.42 g/mol, XLogP of 4.37, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine is sourced from PubChem (CID 150014617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).