C23H31BrN2O — CID 150014617
1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine (PubChem CID 150014617) has the molecular formula C23H31BrN2O and a molecular weight of 431.42 g/mol. Its IUPAC name is 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine.
| Compound Name | 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 150014617 |
| Molecular Formula | C23H31BrN2O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-(2-benzyl-4-morpholin-4-ylphenyl)-4-bromo-N,N-dimethylbutan-2-amine |
| SMILES | CN(C)C(CCBr)Cc1ccc(N2CCOCC2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C23H31BrN2O/c1-25(2)22(10-11-24)17-20-8-9-23(26-12-14-27-15-13-26)18-21(20)16-19-6-4-3-5-7-19/h3-9,18,22H,10-17H2,1-2H3 |
| InChIKey | DDZNYPFIMHYOJN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|