C12H13F4NO3 — CID 150018585
ethyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate (PubChem CID 150018585) has the molecular formula C12H13F4NO3 and a molecular weight of 295.23 g/mol. Its IUPAC name is ethyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | ethyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 150018585 |
| Molecular Formula | C12H13F4NO3 |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | ethyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate |
| SMILES | CCOC(=O)N(OC)C(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F4NO3/c1-3-20-11(18)17(19-2)10(12(14,15)16)8-4-6-9(13)7-5-8/h4-7,10H,3H2,1-2H3 |
| InChIKey | DEUFVAPVYCRBSR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|